C32H37N3O7S — CID 118504873
4-(dimethylamino)-1,10,11,12a-tetrahydroxy-9-[(4-methylcyclohexyl)amino]-3,12-dioxo-7-thiophen-3-yl-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 118504873) has the molecular formula C32H37N3O7S and a molecular weight of 607.73 g/mol. Its IUPAC name is 4-(dimethylamino)-1,10,11,12a-tetrahydroxy-9-[(4-methylcyclohexyl)amino]-3,12-dioxo-7-thiophen-3-yl-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | 4-(dimethylamino)-1,10,11,12a-tetrahydroxy-9-[(4-methylcyclohexyl)amino]-3,12-dioxo-7-thiophen-3-yl-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 118504873 |
| Molecular Formula | C32H37N3O7S |
| Molecular Weight | 607.73 g/mol |
| Exact Mass | 607.24 |
| IUPAC Name | 4-(dimethylamino)-1,10,11,12a-tetrahydroxy-9-[(4-methylcyclohexyl)amino]-3,12-dioxo-7-thiophen-3-yl-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CC1CCC(Nc2cc(-c3ccsc3)c3c(c2O)C(O)=C2C(=O)C4(O)C(O)=C(C(N)=O)C(=O)C(N(C)C)C4CC2C3)CC1 |
| InChI | InChI=1S/C32H37N3O7S/c1-14-4-6-17(7-5-14)34-21-12-18(15-8-9-43-13-15)19-10-16-11-20-25(35(2)3)28(38)24(31(33)41)30(40)32(20,42)29(39)22(16)27(37)23(19)26(21)36/h8-9,12-14,16-17,20,25,34,36-37,40,42H,4-7,10-11H2,1-3H3,(H2,33,41) |
| InChIKey | QCMTXSRSTYWRHM-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 173.42 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.73 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|