C22H26N2O7S — CID 134184777
7-(aminomethyl)-3,10,11,12a-tetrahydroxy-9-(methylsulfanylmethyl)-1,12-dioxo-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide (PubChem CID 134184777) has the molecular formula C22H26N2O7S and a molecular weight of 462.52 g/mol. Its IUPAC name is 7-(aminomethyl)-3,10,11,12a-tetrahydroxy-9-(methylsulfanylmethyl)-1,12-dioxo-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide.
| Compound Name | 7-(aminomethyl)-3,10,11,12a-tetrahydroxy-9-(methylsulfanylmethyl)-1,12-dioxo-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 134184777 |
| Molecular Formula | C22H26N2O7S |
| Molecular Weight | 462.52 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | 7-(aminomethyl)-3,10,11,12a-tetrahydroxy-9-(methylsulfanylmethyl)-1,12-dioxo-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide |
| SMILES | CSCc1cc(CN)c2c(c1O)C(O)=C1C(=O)C3(O)C(=O)C(C(N)=O)C(O)CC3CC1C2 |
| InChI | InChI=1S/C22H26N2O7S/c1-32-7-10-2-9(6-23)12-4-8-3-11-5-13(25)16(21(24)30)20(29)22(11,31)19(28)14(8)18(27)15(12)17(10)26/h2,8,11,13,16,25-27,31H,3-7,23H2,1H3,(H2,24,30) |
| InChIKey | MYUJOGHGUAMKLB-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 184.17 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.52 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|