C26H26N2O8 — CID 137301268
(4aS,5aR,12aR)-3,10,11,12a-tetrahydroxy-9-(methoxymethyl)-1,12-dioxo-7-pyridin-2-yl-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide (PubChem CID 137301268) has the molecular formula C26H26N2O8 and a molecular weight of 494.50 g/mol. Its IUPAC name is (4aS,5aR,12aR)-3,10,11,12a-tetrahydroxy-9-(methoxymethyl)-1,12-dioxo-7-pyridin-2-yl-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide.
| Compound Name | (4aS,5aR,12aR)-3,10,11,12a-tetrahydroxy-9-(methoxymethyl)-1,12-dioxo-7-pyridin-2-yl-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 137301268 |
| Molecular Formula | C26H26N2O8 |
| Molecular Weight | 494.50 g/mol |
| Exact Mass | 494.17 |
| IUPAC Name | (4aS,5aR,12aR)-3,10,11,12a-tetrahydroxy-9-(methoxymethyl)-1,12-dioxo-7-pyridin-2-yl-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide |
| SMILES | COCc1cc(-c2ccccn2)c2c(c1O)C(O)=C1C(=O)[C@]3(O)C(=O)C(C(N)=O)C(O)C[C@@H]3C[C@@H]1C2 |
| InChI | InChI=1S/C26H26N2O8/c1-36-10-12-8-14(16-4-2-3-5-28-16)15-7-11-6-13-9-17(29)20(25(27)34)24(33)26(13,35)23(32)18(11)22(31)19(15)21(12)30/h2-5,8,11,13,17,20,29-31,35H,6-7,9-10H2,1H3,(H2,27,34)/t11-,13+,17?,20?,26+/m1/s1 |
| InChIKey | VXHSHVMLMCNSFW-LSKDZNFXSA-N |
| XLogP | 0.80 |
| TPSA | 180.27 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.50 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|