C27H25NO8 — CID 134184943
(4aS,5aR,12aR)-7-(3-acetylphenyl)-3,10,11,12a-tetrahydroxy-1,12-dioxo-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide (PubChem CID 134184943) has the molecular formula C27H25NO8 and a molecular weight of 491.50 g/mol. Its IUPAC name is (4aS,5aR,12aR)-7-(3-acetylphenyl)-3,10,11,12a-tetrahydroxy-1,12-dioxo-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide.
| Compound Name | (4aS,5aR,12aR)-7-(3-acetylphenyl)-3,10,11,12a-tetrahydroxy-1,12-dioxo-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 134184943 |
| Molecular Formula | C27H25NO8 |
| Molecular Weight | 491.50 g/mol |
| Exact Mass | 491.16 |
| IUPAC Name | (4aS,5aR,12aR)-7-(3-acetylphenyl)-3,10,11,12a-tetrahydroxy-1,12-dioxo-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide |
| SMILES | CC(=O)c1cccc(-c2ccc(O)c3c2C[C@H]2C[C@H]4CC(O)C(C(N)=O)C(=O)[C@@]4(O)C(=O)C2=C3O)c1 |
| InChI | InChI=1S/C27H25NO8/c1-11(29)12-3-2-4-13(7-12)16-5-6-18(30)21-17(16)9-14-8-15-10-19(31)22(26(28)35)25(34)27(15,36)24(33)20(14)23(21)32/h2-7,14-15,19,22,30-32,36H,8-10H2,1H3,(H2,28,35)/t14-,15+,19?,22?,27+/m1/s1 |
| InChIKey | NDDNASGAZNANCG-YLSBJDLOSA-N |
| XLogP | 1.46 |
| TPSA | 175.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.50 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|