C26H24N2O8 — CID 134184678
(4aS,5aR,12aR)-7-(3-carbamoylphenyl)-3,10,11,12a-tetrahydroxy-1,12-dioxo-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide (PubChem CID 134184678) has the molecular formula C26H24N2O8 and a molecular weight of 492.48 g/mol. Its IUPAC name is (4aS,5aR,12aR)-7-(3-carbamoylphenyl)-3,10,11,12a-tetrahydroxy-1,12-dioxo-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide.
| Compound Name | (4aS,5aR,12aR)-7-(3-carbamoylphenyl)-3,10,11,12a-tetrahydroxy-1,12-dioxo-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 134184678 |
| Molecular Formula | C26H24N2O8 |
| Molecular Weight | 492.48 g/mol |
| Exact Mass | 492.15 |
| IUPAC Name | (4aS,5aR,12aR)-7-(3-carbamoylphenyl)-3,10,11,12a-tetrahydroxy-1,12-dioxo-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide |
| SMILES | NC(=O)c1cccc(-c2ccc(O)c3c2C[C@H]2C[C@H]4CC(O)C(C(N)=O)C(=O)[C@@]4(O)C(=O)C2=C3O)c1 |
| InChI | InChI=1S/C26H24N2O8/c27-24(34)11-3-1-2-10(6-11)14-4-5-16(29)19-15(14)8-12-7-13-9-17(30)20(25(28)35)23(33)26(13,36)22(32)18(12)21(19)31/h1-6,12-13,17,20,29-31,36H,7-9H2,(H2,27,34)(H2,28,35)/t12-,13+,17?,20?,26+/m1/s1 |
| InChIKey | MVDSCPOIVYNXHN-JOMXXLORSA-N |
| XLogP | 0.35 |
| TPSA | 201.24 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.48 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|