C29H31FN2O8 — CID 134184999
(4aS,5aR,12aR)-7-[5-[(2-fluoroethylamino)methyl]-2-methoxyphenyl]-3,10,11,12a-tetrahydroxy-1,12-dioxo-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide (PubChem CID 134184999) has the molecular formula C29H31FN2O8 and a molecular weight of 554.57 g/mol. Its IUPAC name is (4aS,5aR,12aR)-7-[5-[(2-fluoroethylamino)methyl]-2-methoxyphenyl]-3,10,11,12a-tetrahydroxy-1,12-dioxo-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide.
| Compound Name | (4aS,5aR,12aR)-7-[5-[(2-fluoroethylamino)methyl]-2-methoxyphenyl]-3,10,11,12a-tetrahydroxy-1,12-dioxo-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 134184999 |
| Molecular Formula | C29H31FN2O8 |
| Molecular Weight | 554.57 g/mol |
| Exact Mass | 554.21 |
| IUPAC Name | (4aS,5aR,12aR)-7-[5-[(2-fluoroethylamino)methyl]-2-methoxyphenyl]-3,10,11,12a-tetrahydroxy-1,12-dioxo-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide |
| SMILES | COc1ccc(CNCCF)cc1-c1ccc(O)c2c1C[C@H]1C[C@H]3CC(O)C(C(N)=O)C(=O)[C@@]3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C29H31FN2O8/c1-40-21-5-2-13(12-32-7-6-30)8-17(21)16-3-4-19(33)23-18(16)10-14-9-15-11-20(34)24(28(31)38)27(37)29(15,39)26(36)22(14)25(23)35/h2-5,8,14-15,20,24,32-35,39H,6-7,9-12H2,1H3,(H2,31,38)/t14-,15+,20?,24?,29+/m1/s1 |
| InChIKey | UUUGUWVABGFXFP-JKZHPCJASA-N |
| XLogP | 1.32 |
| TPSA | 179.41 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.57 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|