C27H25NO9 — CID 134184689
(4aS,5aR,12aR)-7-(5-formyl-2-methoxyphenyl)-3,10,11,12a-tetrahydroxy-1,12-dioxo-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide (PubChem CID 134184689) has the molecular formula C27H25NO9 and a molecular weight of 507.50 g/mol. Its IUPAC name is (4aS,5aR,12aR)-7-(5-formyl-2-methoxyphenyl)-3,10,11,12a-tetrahydroxy-1,12-dioxo-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide.
| Compound Name | (4aS,5aR,12aR)-7-(5-formyl-2-methoxyphenyl)-3,10,11,12a-tetrahydroxy-1,12-dioxo-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 134184689 |
| Molecular Formula | C27H25NO9 |
| Molecular Weight | 507.50 g/mol |
| Exact Mass | 507.15 |
| IUPAC Name | (4aS,5aR,12aR)-7-(5-formyl-2-methoxyphenyl)-3,10,11,12a-tetrahydroxy-1,12-dioxo-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide |
| SMILES | COc1ccc(C=O)cc1-c1ccc(O)c2c1C[C@H]1C[C@H]3CC(O)C(C(N)=O)C(=O)[C@@]3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C27H25NO9/c1-37-19-5-2-11(10-29)6-15(19)14-3-4-17(30)21-16(14)8-12-7-13-9-18(31)22(26(28)35)25(34)27(13,36)24(33)20(12)23(21)32/h2-6,10,12-13,18,22,30-32,36H,7-9H2,1H3,(H2,28,35)/t12-,13+,18?,22?,27+/m1/s1 |
| InChIKey | UQTYOFQTBBSLIX-GKVOQWMXSA-N |
| XLogP | 1.08 |
| TPSA | 184.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.50 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|