C32H34N2O8 — CID 54690002
(4aS,5aR,12aR)-1,10,11,12a-tetrahydroxy-7-[2-methoxy-5-(piperidin-1-ylmethyl)phenyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 54690002) has the molecular formula C32H34N2O8 and a molecular weight of 574.63 g/mol. Its IUPAC name is (4aS,5aR,12aR)-1,10,11,12a-tetrahydroxy-7-[2-methoxy-5-(piperidin-1-ylmethyl)phenyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4aS,5aR,12aR)-1,10,11,12a-tetrahydroxy-7-[2-methoxy-5-(piperidin-1-ylmethyl)phenyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 54690002 |
| Molecular Formula | C32H34N2O8 |
| Molecular Weight | 574.63 g/mol |
| Exact Mass | 574.23 |
| IUPAC Name | (4aS,5aR,12aR)-1,10,11,12a-tetrahydroxy-7-[2-methoxy-5-(piperidin-1-ylmethyl)phenyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | COc1ccc(CN2CCCCC2)cc1-c1ccc(O)c2c1C[C@H]1C[C@H]3CC(=O)C(C(N)=O)=C(O)[C@@]3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C32H34N2O8/c1-42-24-8-5-16(15-34-9-3-2-4-10-34)11-20(24)19-6-7-22(35)26-21(19)13-17-12-18-14-23(36)27(31(33)40)30(39)32(18,41)29(38)25(17)28(26)37/h5-8,11,17-18,35,37,39,41H,2-4,9-10,12-15H2,1H3,(H2,33,40)/t17-,18+,32+/m1/s1 |
| InChIKey | INONJHBTYKRDMF-DSMAOHMUSA-N |
| XLogP | 3.09 |
| TPSA | 170.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.63 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|