C33H37N3O10 — CID 137475990
ethyl 2-[[3-[(6aR,10R,10aS,11aS)-8-carbamoyl-10-(dimethylamino)-4,5,6a,7-tetrahydroxy-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-tetracen-1-yl]-4-methoxyphenyl]methylamino]acetate (PubChem CID 137475990) has the molecular formula C33H37N3O10 and a molecular weight of 635.67 g/mol. Its IUPAC name is ethyl 2-[[3-[(6aR,10R,10aS,11aS)-8-carbamoyl-10-(dimethylamino)-4,5,6a,7-tetrahydroxy-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-tetracen-1-yl]-4-methoxyphenyl]methylamino]acetate.
| Compound Name | ethyl 2-[[3-[(6aR,10R,10aS,11aS)-8-carbamoyl-10-(dimethylamino)-4,5,6a,7-tetrahydroxy-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-tetracen-1-yl]-4-methoxyphenyl]methylamino]acetate |
|---|---|
| PubChem CID | 137475990 |
| Molecular Formula | C33H37N3O10 |
| Molecular Weight | 635.67 g/mol |
| Exact Mass | 635.25 |
| IUPAC Name | ethyl 2-[[3-[(6aR,10R,10aS,11aS)-8-carbamoyl-10-(dimethylamino)-4,5,6a,7-tetrahydroxy-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-tetracen-1-yl]-4-methoxyphenyl]methylamino]acetate |
| SMILES | CCOC(=O)CNCc1ccc(OC)c(-c2ccc(O)c3c2C[C@@H]2C[C@H]4[C@@H](N(C)C)C(=O)C(C(N)=O)=C(O)[C@@]4(O)C(=O)C2=C3O)c1 |
| InChI | InChI=1S/C33H37N3O10/c1-5-46-23(38)14-35-13-15-6-9-22(45-4)18(10-15)17-7-8-21(37)25-19(17)11-16-12-20-27(36(2)3)29(40)26(32(34)43)31(42)33(20,44)30(41)24(16)28(25)39/h6-10,16,20,27,35,37,39,42,44H,5,11-14H2,1-4H3,(H2,34,43)/t16-,20+,27-,33+/m1/s1 |
| InChIKey | WNMODQOLGDAICQ-HTJDYPPXSA-N |
| XLogP | 1.29 |
| TPSA | 208.95 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.67 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|