C36H37N3O9 — CID 58461320
ethyl 2-[[4-[(6aS,10aR,11aS)-8-carbamoyl-10-(dimethylamino)-4,5,6a,7-tetrahydroxy-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-tetracen-1-yl]naphthalen-1-yl]methylamino]acetate (PubChem CID 58461320) has the molecular formula C36H37N3O9 and a molecular weight of 655.70 g/mol. Its IUPAC name is ethyl 2-[[4-[(6aS,10aR,11aS)-8-carbamoyl-10-(dimethylamino)-4,5,6a,7-tetrahydroxy-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-tetracen-1-yl]naphthalen-1-yl]methylamino]acetate.
| Compound Name | ethyl 2-[[4-[(6aS,10aR,11aS)-8-carbamoyl-10-(dimethylamino)-4,5,6a,7-tetrahydroxy-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-tetracen-1-yl]naphthalen-1-yl]methylamino]acetate |
|---|---|
| PubChem CID | 58461320 |
| Molecular Formula | C36H37N3O9 |
| Molecular Weight | 655.70 g/mol |
| Exact Mass | 655.25 |
| IUPAC Name | ethyl 2-[[4-[(6aS,10aR,11aS)-8-carbamoyl-10-(dimethylamino)-4,5,6a,7-tetrahydroxy-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-tetracen-1-yl]naphthalen-1-yl]methylamino]acetate |
| SMILES | CCOC(=O)CNCc1ccc(-c2ccc(O)c3c2C[C@@H]2C[C@@H]4C(N(C)C)C(=O)C(C(N)=O)=C(O)[C@]4(O)C(=O)C2=C3O)c2ccccc12 |
| InChI | InChI=1S/C36H37N3O9/c1-4-48-26(41)16-38-15-17-9-10-21(20-8-6-5-7-19(17)20)22-11-12-25(40)28-23(22)13-18-14-24-30(39(2)3)32(43)29(35(37)46)34(45)36(24,47)33(44)27(18)31(28)42/h5-12,18,24,30,38,40,42,45,47H,4,13-16H2,1-3H3,(H2,37,46)/t18-,24-,30?,36-/m1/s1 |
| InChIKey | SRUGJDOBFZJVKE-KTIOTTAYSA-N |
| XLogP | 2.44 |
| TPSA | 199.72 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.70 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|