C30H30N2O9 — CID 54703437
ethyl 2-[(6aR,10S)-8-carbamoyl-10-(dimethylamino)-4,5,6a,7-tetrahydroxy-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-tetracen-1-yl]benzoate (PubChem CID 54703437) has the molecular formula C30H30N2O9 and a molecular weight of 562.58 g/mol. Its IUPAC name is ethyl 2-[(6aR,10S)-8-carbamoyl-10-(dimethylamino)-4,5,6a,7-tetrahydroxy-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-tetracen-1-yl]benzoate.
| Compound Name | ethyl 2-[(6aR,10S)-8-carbamoyl-10-(dimethylamino)-4,5,6a,7-tetrahydroxy-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-tetracen-1-yl]benzoate |
|---|---|
| PubChem CID | 54703437 |
| Molecular Formula | C30H30N2O9 |
| Molecular Weight | 562.58 g/mol |
| Exact Mass | 562.20 |
| IUPAC Name | ethyl 2-[(6aR,10S)-8-carbamoyl-10-(dimethylamino)-4,5,6a,7-tetrahydroxy-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-tetracen-1-yl]benzoate |
| SMILES | CCOC(=O)c1ccccc1-c1ccc(O)c2c1CC1CC3[C@H](N(C)C)C(=O)C(C(N)=O)=C(O)[C@@]3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C30H30N2O9/c1-4-41-29(39)16-8-6-5-7-14(16)15-9-10-19(33)21-17(15)11-13-12-18-23(32(2)3)25(35)22(28(31)38)27(37)30(18,40)26(36)20(13)24(21)34/h5-10,13,18,23,33-34,37,40H,4,11-12H2,1-3H3,(H2,31,38)/t13?,18?,23-,30-/m0/s1 |
| InChIKey | VQTMCHCCCGWRQX-BLWNAPCYSA-N |
| XLogP | 1.81 |
| TPSA | 187.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.58 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|