C26H30F3N3O7 — CID 70295405
(4S)-4-(dimethylamino)-1,3,10,11-tetrahydroxy-1-methyl-12-oxo-7-[2-(2,2,2-trifluoroethylamino)acetyl]-4,4a,5,5a,6,12a-hexahydrotetracene-2-carboxamide (PubChem CID 70295405) has the molecular formula C26H30F3N3O7 and a molecular weight of 553.53 g/mol. Its IUPAC name is (4S)-4-(dimethylamino)-1,3,10,11-tetrahydroxy-1-methyl-12-oxo-7-[2-(2,2,2-trifluoroethylamino)acetyl]-4,4a,5,5a,6,12a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4S)-4-(dimethylamino)-1,3,10,11-tetrahydroxy-1-methyl-12-oxo-7-[2-(2,2,2-trifluoroethylamino)acetyl]-4,4a,5,5a,6,12a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 70295405 |
| Molecular Formula | C26H30F3N3O7 |
| Molecular Weight | 553.53 g/mol |
| Exact Mass | 553.20 |
| IUPAC Name | (4S)-4-(dimethylamino)-1,3,10,11-tetrahydroxy-1-methyl-12-oxo-7-[2-(2,2,2-trifluoroethylamino)acetyl]-4,4a,5,5a,6,12a-hexahydrotetracene-2-carboxamide |
| SMILES | CN(C)[C@@H]1C(O)=C(C(N)=O)C(C)(O)C2C(=O)C3=C(O)c4c(O)ccc(C(=O)CNCC(F)(F)F)c4CC3CC21 |
| InChI | InChI=1S/C26H30F3N3O7/c1-25(39)18-13(20(32(2)3)23(37)19(25)24(30)38)7-10-6-12-11(15(34)8-31-9-26(27,28)29)4-5-14(33)17(12)21(35)16(10)22(18)36/h4-5,10,13,18,20,31,33,35,37,39H,6-9H2,1-3H3,(H2,30,38)/t10?,13?,18?,20-,25?/m0/s1 |
| InChIKey | WXQIGGKLMAQMAA-VCRCTTEHSA-N |
| XLogP | 1.37 |
| TPSA | 173.42 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.53 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |