C29H33N3O9 — CID 118554348
methyl N-[2-[(6aS,10R,10aR,11aR)-8-carbamoyl-10-(dimethylamino)-4,5,7-trihydroxy-6a-methyl-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-tetracen-1-yl]-2-oxoethyl]-N-cyclopropylcarbamate (PubChem CID 118554348) has the molecular formula C29H33N3O9 and a molecular weight of 567.60 g/mol. Its IUPAC name is methyl N-[2-[(6aS,10R,10aR,11aR)-8-carbamoyl-10-(dimethylamino)-4,5,7-trihydroxy-6a-methyl-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-tetracen-1-yl]-2-oxoethyl]-N-cyclopropylcarbamate.
| Compound Name | methyl N-[2-[(6aS,10R,10aR,11aR)-8-carbamoyl-10-(dimethylamino)-4,5,7-trihydroxy-6a-methyl-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-tetracen-1-yl]-2-oxoethyl]-N-cyclopropylcarbamate |
|---|---|
| PubChem CID | 118554348 |
| Molecular Formula | C29H33N3O9 |
| Molecular Weight | 567.60 g/mol |
| Exact Mass | 567.22 |
| IUPAC Name | methyl N-[2-[(6aS,10R,10aR,11aR)-8-carbamoyl-10-(dimethylamino)-4,5,7-trihydroxy-6a-methyl-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-tetracen-1-yl]-2-oxoethyl]-N-cyclopropylcarbamate |
| SMILES | COC(=O)N(CC(=O)c1ccc(O)c2c1C[C@H]1C[C@H]3[C@@H](N(C)C)C(=O)C(C(N)=O)=C(O)[C@@]3(C)C(=O)C1=C2O)C1CC1 |
| InChI | InChI=1S/C29H33N3O9/c1-29-16(22(31(2)3)24(36)21(26(29)38)27(30)39)10-12-9-15-14(18(34)11-32(13-5-6-13)28(40)41-4)7-8-17(33)20(15)23(35)19(12)25(29)37/h7-8,12-13,16,22,33,35,38H,5-6,9-11H2,1-4H3,(H2,30,39)/t12-,16-,22+,29+/m0/s1 |
| InChIKey | LYUZMIINWDCWQC-NBPORVONSA-N |
| XLogP | 1.65 |
| TPSA | 187.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.60 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|