C32H37N3O6 — CID 70790706
(4S)-7-[3-[(cyclopropylamino)methyl]phenyl]-4-(dimethylamino)-1,3,10,11-tetrahydroxy-1-methyl-12-oxo-4,4a,5,5a,6,12a-hexahydrotetracene-2-carboxamide (PubChem CID 70790706) has the molecular formula C32H37N3O6 and a molecular weight of 559.66 g/mol. Its IUPAC name is (4S)-7-[3-[(cyclopropylamino)methyl]phenyl]-4-(dimethylamino)-1,3,10,11-tetrahydroxy-1-methyl-12-oxo-4,4a,5,5a,6,12a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4S)-7-[3-[(cyclopropylamino)methyl]phenyl]-4-(dimethylamino)-1,3,10,11-tetrahydroxy-1-methyl-12-oxo-4,4a,5,5a,6,12a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 70790706 |
| Molecular Formula | C32H37N3O6 |
| Molecular Weight | 559.66 g/mol |
| Exact Mass | 559.27 |
| IUPAC Name | (4S)-7-[3-[(cyclopropylamino)methyl]phenyl]-4-(dimethylamino)-1,3,10,11-tetrahydroxy-1-methyl-12-oxo-4,4a,5,5a,6,12a-hexahydrotetracene-2-carboxamide |
| SMILES | CN(C)[C@@H]1C(O)=C(C(N)=O)C(C)(O)C2C(=O)C3=C(O)c4c(O)ccc(-c5cccc(CNC6CC6)c5)c4CC3CC21 |
| InChI | InChI=1S/C32H37N3O6/c1-32(41)25-21(27(35(2)3)30(39)26(32)31(33)40)13-17-12-20-19(9-10-22(36)24(20)28(37)23(17)29(25)38)16-6-4-5-15(11-16)14-34-18-7-8-18/h4-6,9-11,17-18,21,25,27,34,36-37,39,41H,7-8,12-14H2,1-3H3,(H2,33,40)/t17?,21?,25?,27-,32?/m0/s1 |
| InChIKey | DBGADCXSCRLLOH-SELBONMVSA-N |
| XLogP | 2.95 |
| TPSA | 156.35 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.66 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |