C30H43N5O8 — CID 54735840
(4S,4aR,5aR)-9-[[2-(tert-butylamino)acetyl]amino]-4,7-bis(dimethylamino)-3,10,11-trihydroxy-1,12-dioxo-4,4a,5,5a,6,12a-hexahydrotetracene-2-carboxamide;methanol (PubChem CID 54735840) has the molecular formula C30H43N5O8 and a molecular weight of 601.70 g/mol. Its IUPAC name is (4S,4aR,5aR)-9-[[2-(tert-butylamino)acetyl]amino]-4,7-bis(dimethylamino)-3,10,11-trihydroxy-1,12-dioxo-4,4a,5,5a,6,12a-hexahydrotetracene-2-carboxamide;methanol.
| Compound Name | (4S,4aR,5aR)-9-[[2-(tert-butylamino)acetyl]amino]-4,7-bis(dimethylamino)-3,10,11-trihydroxy-1,12-dioxo-4,4a,5,5a,6,12a-hexahydrotetracene-2-carboxamide;methanol |
|---|---|
| PubChem CID | 54735840 |
| Molecular Formula | C30H43N5O8 |
| Molecular Weight | 601.70 g/mol |
| Exact Mass | 601.31 |
| IUPAC Name | (4S,4aR,5aR)-9-[[2-(tert-butylamino)acetyl]amino]-4,7-bis(dimethylamino)-3,10,11-trihydroxy-1,12-dioxo-4,4a,5,5a,6,12a-hexahydrotetracene-2-carboxamide;methanol |
| SMILES | CN(C)c1cc(NC(=O)CNC(C)(C)C)c(O)c2c1C[C@H]1C[C@@H]3C(C(=O)C(C(N)=O)=C(O)[C@H]3N(C)C)C(=O)C1=C2O.CO |
| InChI | InChI=1S/C29H39N5O7.CH4O/c1-29(2,3)31-11-17(35)32-15-10-16(33(4)5)13-8-12-9-14-20(25(38)18(12)24(37)19(13)23(15)36)26(39)21(28(30)41)27(40)22(14)34(6)7;1-2/h10,12,14,20,22,31,36-37,40H,8-9,11H2,1-7H3,(H2,30,41)(H,32,35);2H,1H3/t12-,14+,20?,22-;/m0./s1 |
| InChIKey | FCXZVTMLQRLEMR-XJGZLVKWSA-N |
| XLogP | 0.85 |
| TPSA | 205.76 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.70 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|