C28H38N4O7 — CID 143580518
4,7-bis(dimethylamino)-3,10-dihydroxy-12-(2-methoxyethoxy)-9-(methylaminomethyl)-1,11-dioxo-4,4a,5,5a,6,12a-hexahydrotetracene-2-carboxamide (PubChem CID 143580518) has the molecular formula C28H38N4O7 and a molecular weight of 542.63 g/mol. Its IUPAC name is 4,7-bis(dimethylamino)-3,10-dihydroxy-12-(2-methoxyethoxy)-9-(methylaminomethyl)-1,11-dioxo-4,4a,5,5a,6,12a-hexahydrotetracene-2-carboxamide.
| Compound Name | 4,7-bis(dimethylamino)-3,10-dihydroxy-12-(2-methoxyethoxy)-9-(methylaminomethyl)-1,11-dioxo-4,4a,5,5a,6,12a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 143580518 |
| Molecular Formula | C28H38N4O7 |
| Molecular Weight | 542.63 g/mol |
| Exact Mass | 542.27 |
| IUPAC Name | 4,7-bis(dimethylamino)-3,10-dihydroxy-12-(2-methoxyethoxy)-9-(methylaminomethyl)-1,11-dioxo-4,4a,5,5a,6,12a-hexahydrotetracene-2-carboxamide |
| SMILES | CNCc1cc(N(C)C)c2c(c1O)C(=O)C1=C(OCCOC)C3C(=O)C(C(N)=O)=C(O)C(N(C)C)C3CC1C2 |
| InChI | InChI=1S/C28H38N4O7/c1-30-12-14-11-17(31(2)3)15-9-13-10-16-20(25(35)21(28(29)37)26(36)22(16)32(4)5)27(39-8-7-38-6)18(13)24(34)19(15)23(14)33/h11,13,16,20,22,30,33,36H,7-10,12H2,1-6H3,(H2,29,37) |
| InChIKey | BTPLZGQRFQQEGH-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 154.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.63 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|