C32H36N3O7+ — CID 163689552
[8-(3-acetylphenyl)-3-carbamoyl-10-(dimethylamino)-2,7-dihydroxy-5-methoxy-4,6-dioxo-1,4a,11,11a,12,12a-hexahydrotetracen-1-yl]-dimethylazanium (PubChem CID 163689552) has the molecular formula C32H36N3O7+ and a molecular weight of 574.65 g/mol. Its IUPAC name is [8-(3-acetylphenyl)-3-carbamoyl-10-(dimethylamino)-2,7-dihydroxy-5-methoxy-4,6-dioxo-1,4a,11,11a,12,12a-hexahydrotetracen-1-yl]-dimethylazanium.
| Compound Name | [8-(3-acetylphenyl)-3-carbamoyl-10-(dimethylamino)-2,7-dihydroxy-5-methoxy-4,6-dioxo-1,4a,11,11a,12,12a-hexahydrotetracen-1-yl]-dimethylazanium |
|---|---|
| PubChem CID | 163689552 |
| Molecular Formula | C32H36N3O7+ |
| Molecular Weight | 574.65 g/mol |
| Exact Mass | 574.25 |
| IUPAC Name | [8-(3-acetylphenyl)-3-carbamoyl-10-(dimethylamino)-2,7-dihydroxy-5-methoxy-4,6-dioxo-1,4a,11,11a,12,12a-hexahydrotetracen-1-yl]-dimethylazanium |
| SMILES | COC1=C2C(=O)c3c(O)c(-c4cccc(C(C)=O)c4)cc(N(C)C)c3CC2CC2C1C(=O)C(C(N)=O)=C(O)C2[NH+](C)C |
| InChI | InChI=1S/C32H35N3O7/c1-14(36)15-8-7-9-16(10-15)18-13-21(34(2)3)19-11-17-12-20-24(31(42-6)22(17)28(38)23(19)27(18)37)29(39)25(32(33)41)30(40)26(20)35(4)5/h7-10,13,17,20,24,26,37,40H,11-12H2,1-6H3,(H2,33,41)/p+1 |
| InChIKey | JRTQLRWDGOTJME-UHFFFAOYSA-O |
| XLogP | 1.61 |
| TPSA | 151.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.65 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|