C29H29N3O7 — CID 123974067
9-(3-acetamidophenyl)-7-(dimethylamino)-10-hydroxy-1,3,11,12-tetraoxo-4a,5,5a,6,11a,12a-hexahydro-4H-tetracene-2-carboxamide (PubChem CID 123974067) has the molecular formula C29H29N3O7 and a molecular weight of 531.57 g/mol. Its IUPAC name is 9-(3-acetamidophenyl)-7-(dimethylamino)-10-hydroxy-1,3,11,12-tetraoxo-4a,5,5a,6,11a,12a-hexahydro-4H-tetracene-2-carboxamide.
| Compound Name | 9-(3-acetamidophenyl)-7-(dimethylamino)-10-hydroxy-1,3,11,12-tetraoxo-4a,5,5a,6,11a,12a-hexahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 123974067 |
| Molecular Formula | C29H29N3O7 |
| Molecular Weight | 531.57 g/mol |
| Exact Mass | 531.20 |
| IUPAC Name | 9-(3-acetamidophenyl)-7-(dimethylamino)-10-hydroxy-1,3,11,12-tetraoxo-4a,5,5a,6,11a,12a-hexahydro-4H-tetracene-2-carboxamide |
| SMILES | CC(=O)Nc1cccc(-c2cc(N(C)C)c3c(c2O)C(=O)C2C(=O)C4C(=O)C(C(N)=O)C(=O)CC4CC2C3)c1 |
| InChI | InChI=1S/C29H29N3O7/c1-12(33)31-16-6-4-5-13(8-16)17-11-19(32(2)3)18-9-14-7-15-10-20(34)24(29(30)39)28(38)22(15)26(36)21(14)27(37)23(18)25(17)35/h4-6,8,11,14-15,21-22,24,35H,7,9-10H2,1-3H3,(H2,30,39)(H,31,33) |
| InChIKey | VILYGRVUTPEKBU-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 163.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.57 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|