C27H34N2O6S — CID 91528605
7-[(2,2-dimethylpropylamino)methyl]-10-hydroxy-9-(methylsulfanylmethyl)-1,3,11,12-tetraoxo-4a,5,5a,6,11a,12a-hexahydro-4H-tetracene-2-carboxamide (PubChem CID 91528605) has the molecular formula C27H34N2O6S and a molecular weight of 514.64 g/mol. Its IUPAC name is 7-[(2,2-dimethylpropylamino)methyl]-10-hydroxy-9-(methylsulfanylmethyl)-1,3,11,12-tetraoxo-4a,5,5a,6,11a,12a-hexahydro-4H-tetracene-2-carboxamide.
| Compound Name | 7-[(2,2-dimethylpropylamino)methyl]-10-hydroxy-9-(methylsulfanylmethyl)-1,3,11,12-tetraoxo-4a,5,5a,6,11a,12a-hexahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 91528605 |
| Molecular Formula | C27H34N2O6S |
| Molecular Weight | 514.64 g/mol |
| Exact Mass | 514.21 |
| IUPAC Name | 7-[(2,2-dimethylpropylamino)methyl]-10-hydroxy-9-(methylsulfanylmethyl)-1,3,11,12-tetraoxo-4a,5,5a,6,11a,12a-hexahydro-4H-tetracene-2-carboxamide |
| SMILES | CSCc1cc(CNCC(C)(C)C)c2c(c1O)C(=O)C1C(=O)C3C(=O)C(C(N)=O)C(=O)CC3CC1C2 |
| InChI | InChI=1S/C27H34N2O6S/c1-27(2,3)11-29-9-14-6-15(10-36-4)22(31)20-16(14)7-12-5-13-8-17(30)21(26(28)35)25(34)19(13)23(32)18(12)24(20)33/h6,12-13,18-19,21,29,31H,5,7-11H2,1-4H3,(H2,28,35) |
| InChIKey | LGKNTTXSTVCPHW-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 143.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.64 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|