C26H28N2O7 — CID 123969494
7-[(E)-3-(tert-butylamino)-3-oxoprop-1-enyl]-10-hydroxy-1,3,11,12-tetraoxo-4a,5,5a,6,11a,12a-hexahydro-4H-tetracene-2-carboxamide (PubChem CID 123969494) has the molecular formula C26H28N2O7 and a molecular weight of 480.52 g/mol. Its IUPAC name is 7-[(E)-3-(tert-butylamino)-3-oxoprop-1-enyl]-10-hydroxy-1,3,11,12-tetraoxo-4a,5,5a,6,11a,12a-hexahydro-4H-tetracene-2-carboxamide.
| Compound Name | 7-[(E)-3-(tert-butylamino)-3-oxoprop-1-enyl]-10-hydroxy-1,3,11,12-tetraoxo-4a,5,5a,6,11a,12a-hexahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 123969494 |
| Molecular Formula | C26H28N2O7 |
| Molecular Weight | 480.52 g/mol |
| Exact Mass | 480.19 |
| IUPAC Name | 7-[(E)-3-(tert-butylamino)-3-oxoprop-1-enyl]-10-hydroxy-1,3,11,12-tetraoxo-4a,5,5a,6,11a,12a-hexahydro-4H-tetracene-2-carboxamide |
| SMILES | CC(C)(C)NC(=O)/C=C/c1ccc(O)c2c1CC1CC3CC(=O)C(C(N)=O)C(=O)C3C(=O)C1C2=O |
| InChI | InChI=1S/C26H28N2O7/c1-26(2,3)28-17(31)7-5-11-4-6-15(29)20-14(11)9-12-8-13-10-16(30)21(25(27)35)24(34)19(13)22(32)18(12)23(20)33/h4-7,12-13,18-19,21,29H,8-10H2,1-3H3,(H2,27,35)(H,28,31)/b7-5+ |
| InChIKey | INLGIYTWRIIHQH-FNORWQNLSA-N |
| XLogP | 1.14 |
| TPSA | 160.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.52 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|