C25H20ClNO6 — CID 137092441
2-acetyl-7-(3-chloro-4-pyridinyl)-10-hydroxy-4a,5,5a,6,11a,12a-hexahydro-4H-tetracene-1,3,11,12-tetrone (PubChem CID 137092441) has the molecular formula C25H20ClNO6 and a molecular weight of 465.89 g/mol. Its IUPAC name is 2-acetyl-7-(3-chloro-4-pyridinyl)-10-hydroxy-4a,5,5a,6,11a,12a-hexahydro-4H-tetracene-1,3,11,12-tetrone.
| Compound Name | 2-acetyl-7-(3-chloro-4-pyridinyl)-10-hydroxy-4a,5,5a,6,11a,12a-hexahydro-4H-tetracene-1,3,11,12-tetrone |
|---|---|
| PubChem CID | 137092441 |
| Molecular Formula | C25H20ClNO6 |
| Molecular Weight | 465.89 g/mol |
| Exact Mass | 465.10 |
| IUPAC Name | 2-acetyl-7-(3-chloro-4-pyridinyl)-10-hydroxy-4a,5,5a,6,11a,12a-hexahydro-4H-tetracene-1,3,11,12-tetrone |
| SMILES | CC(=O)C1C(=O)CC2CC3Cc4c(-c5ccncc5Cl)ccc(O)c4C(=O)C3C(=O)C2C1=O |
| InChI | InChI=1S/C25H20ClNO6/c1-10(28)19-18(30)8-12-6-11-7-15-13(14-4-5-27-9-16(14)26)2-3-17(29)22(15)25(33)20(11)24(32)21(12)23(19)31/h2-5,9,11-12,19-21,29H,6-8H2,1H3 |
| InChIKey | KOWFMOSXVHSZMU-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 118.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.89 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|