C27H24O7 — CID 123962072
(4aS,5aR,12aS)-2-acetyl-10,12a-dihydroxy-7-(3-methylphenyl)-4,4a,5,5a,6,11a-hexahydrotetracene-1,3,11,12-tetrone (PubChem CID 123962072) has the molecular formula C27H24O7 and a molecular weight of 460.48 g/mol. Its IUPAC name is (4aS,5aR,12aS)-2-acetyl-10,12a-dihydroxy-7-(3-methylphenyl)-4,4a,5,5a,6,11a-hexahydrotetracene-1,3,11,12-tetrone.
| Compound Name | (4aS,5aR,12aS)-2-acetyl-10,12a-dihydroxy-7-(3-methylphenyl)-4,4a,5,5a,6,11a-hexahydrotetracene-1,3,11,12-tetrone |
|---|---|
| PubChem CID | 123962072 |
| Molecular Formula | C27H24O7 |
| Molecular Weight | 460.48 g/mol |
| Exact Mass | 460.15 |
| IUPAC Name | (4aS,5aR,12aS)-2-acetyl-10,12a-dihydroxy-7-(3-methylphenyl)-4,4a,5,5a,6,11a-hexahydrotetracene-1,3,11,12-tetrone |
| SMILES | CC(=O)C1C(=O)C[C@@H]2C[C@@H]3Cc4c(-c5cccc(C)c5)ccc(O)c4C(=O)C3C(=O)[C@]2(O)C1=O |
| InChI | InChI=1S/C27H24O7/c1-12-4-3-5-14(8-12)17-6-7-19(29)23-18(17)10-15-9-16-11-20(30)21(13(2)28)25(32)27(16,34)26(33)22(15)24(23)31/h3-8,15-16,21-22,29,34H,9-11H2,1-2H3/t15-,16+,21?,22?,27-/m1/s1 |
| InChIKey | ZQSKCUSJMZMPOQ-MBZHDSKASA-N |
| XLogP | 2.41 |
| TPSA | 125.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.48 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|