C27H25NO8 — CID 91588591
(4aS,5aR,12aS)-7-(4-ethoxyphenyl)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 91588591) has the molecular formula C27H25NO8 and a molecular weight of 491.50 g/mol. Its IUPAC name is (4aS,5aR,12aS)-7-(4-ethoxyphenyl)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4aS,5aR,12aS)-7-(4-ethoxyphenyl)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 91588591 |
| Molecular Formula | C27H25NO8 |
| Molecular Weight | 491.50 g/mol |
| Exact Mass | 491.16 |
| IUPAC Name | (4aS,5aR,12aS)-7-(4-ethoxyphenyl)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CCOc1ccc(-c2ccc(O)c3c2C[C@H]2C[C@H]4CC(=O)C(C(N)=O)C(=O)[C@@]4(O)C(=O)C2C3=O)cc1 |
| InChI | InChI=1S/C27H25NO8/c1-2-36-15-5-3-12(4-6-15)16-7-8-18(29)21-17(16)10-13-9-14-11-19(30)22(26(28)34)25(33)27(14,35)24(32)20(13)23(21)31/h3-8,13-14,20,22,29,35H,2,9-11H2,1H3,(H2,28,34)/t13-,14+,20?,22?,27+/m1/s1 |
| InChIKey | GKIYKCMQLJPFKO-SXJXKZTESA-N |
| XLogP | 1.39 |
| TPSA | 161.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.50 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|