C27H22ClNO7 — CID 91268587
(4aS,5aR,12aS)-7-[(Z)-2-chloro-2-phenylethenyl]-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 91268587) has the molecular formula C27H22ClNO7 and a molecular weight of 507.93 g/mol. Its IUPAC name is (4aS,5aR,12aS)-7-[(Z)-2-chloro-2-phenylethenyl]-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4aS,5aR,12aS)-7-[(Z)-2-chloro-2-phenylethenyl]-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 91268587 |
| Molecular Formula | C27H22ClNO7 |
| Molecular Weight | 507.93 g/mol |
| Exact Mass | 507.11 |
| IUPAC Name | (4aS,5aR,12aS)-7-[(Z)-2-chloro-2-phenylethenyl]-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | NC(=O)C1C(=O)C[C@@H]2C[C@@H]3Cc4c(/C=C(\Cl)c5ccccc5)ccc(O)c4C(=O)C3C(=O)[C@]2(O)C1=O |
| InChI | InChI=1S/C27H22ClNO7/c28-17(12-4-2-1-3-5-12)10-13-6-7-18(30)21-16(13)9-14-8-15-11-19(31)22(26(29)35)25(34)27(15,36)24(33)20(14)23(21)32/h1-7,10,14-15,20,22,30,36H,8-9,11H2,(H2,29,35)/b17-10-/t14-,15+,20?,22?,27+/m1/s1 |
| InChIKey | ACJICXSHDJLMIK-PEKOXFFLSA-N |
| XLogP | 2.06 |
| TPSA | 151.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.93 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|