C28H26N2O9 — CID 91125654
(4aS,5aR,12aS)-10,12a-dihydroxy-7-[4-methoxy-3-(methoxyiminomethyl)phenyl]-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 91125654) has the molecular formula C28H26N2O9 and a molecular weight of 534.52 g/mol. Its IUPAC name is (4aS,5aR,12aS)-10,12a-dihydroxy-7-[4-methoxy-3-(methoxyiminomethyl)phenyl]-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4aS,5aR,12aS)-10,12a-dihydroxy-7-[4-methoxy-3-(methoxyiminomethyl)phenyl]-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 91125654 |
| Molecular Formula | C28H26N2O9 |
| Molecular Weight | 534.52 g/mol |
| Exact Mass | 534.16 |
| IUPAC Name | (4aS,5aR,12aS)-10,12a-dihydroxy-7-[4-methoxy-3-(methoxyiminomethyl)phenyl]-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CON=Cc1cc(-c2ccc(O)c3c2C[C@H]2C[C@H]4CC(=O)C(C(N)=O)C(=O)[C@@]4(O)C(=O)C2C3=O)ccc1OC |
| InChI | InChI=1S/C28H26N2O9/c1-38-20-6-3-12(7-14(20)11-30-39-2)16-4-5-18(31)22-17(16)9-13-8-15-10-19(32)23(27(29)36)26(35)28(15,37)25(34)21(13)24(22)33/h3-7,11,13,15,21,23,31,37H,8-10H2,1-2H3,(H2,29,36)/t13-,15+,21?,23?,28+/m1/s1 |
| InChIKey | MJMVBAVILUVLHC-CUPCHVQQSA-N |
| XLogP | 0.98 |
| TPSA | 182.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.52 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|