C33H34N2O9 — CID 91534212
methyl 1-[[4-[(6aS,10aS,11aR)-8-carbamoyl-4,6a-dihydroxy-5,6,7,9-tetraoxo-5a,10,10a,11,11a,12-hexahydrotetracen-1-yl]phenyl]methyl]piperidine-4-carboxylate (PubChem CID 91534212) has the molecular formula C33H34N2O9 and a molecular weight of 602.64 g/mol. Its IUPAC name is methyl 1-[[4-[(6aS,10aS,11aR)-8-carbamoyl-4,6a-dihydroxy-5,6,7,9-tetraoxo-5a,10,10a,11,11a,12-hexahydrotetracen-1-yl]phenyl]methyl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[[4-[(6aS,10aS,11aR)-8-carbamoyl-4,6a-dihydroxy-5,6,7,9-tetraoxo-5a,10,10a,11,11a,12-hexahydrotetracen-1-yl]phenyl]methyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 91534212 |
| Molecular Formula | C33H34N2O9 |
| Molecular Weight | 602.64 g/mol |
| Exact Mass | 602.23 |
| IUPAC Name | methyl 1-[[4-[(6aS,10aS,11aR)-8-carbamoyl-4,6a-dihydroxy-5,6,7,9-tetraoxo-5a,10,10a,11,11a,12-hexahydrotetracen-1-yl]phenyl]methyl]piperidine-4-carboxylate |
| SMILES | COC(=O)C1CCN(Cc2ccc(-c3ccc(O)c4c3C[C@H]3C[C@H]5CC(=O)C(C(N)=O)C(=O)[C@@]5(O)C(=O)C3C4=O)cc2)CC1 |
| InChI | InChI=1S/C33H34N2O9/c1-44-32(42)18-8-10-35(11-9-18)15-16-2-4-17(5-3-16)21-6-7-23(36)26-22(21)13-19-12-20-14-24(37)27(31(34)41)30(40)33(20,43)29(39)25(19)28(26)38/h2-7,18-20,25,27,36,43H,8-15H2,1H3,(H2,34,41)/t19-,20+,25?,27?,33+/m1/s1 |
| InChIKey | ANPTUMIJQDLUSZ-AYTBTHQZSA-N |
| XLogP | 1.38 |
| TPSA | 181.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.64 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|