C29H28ClN3O8 — CID 91531052
(4aS,5aR,12aS)-7-[4-(3-chloropropylcarbamoylamino)phenyl]-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 91531052) has the molecular formula C29H28ClN3O8 and a molecular weight of 582.01 g/mol. Its IUPAC name is (4aS,5aR,12aS)-7-[4-(3-chloropropylcarbamoylamino)phenyl]-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4aS,5aR,12aS)-7-[4-(3-chloropropylcarbamoylamino)phenyl]-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 91531052 |
| Molecular Formula | C29H28ClN3O8 |
| Molecular Weight | 582.01 g/mol |
| Exact Mass | 581.16 |
| IUPAC Name | (4aS,5aR,12aS)-7-[4-(3-chloropropylcarbamoylamino)phenyl]-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | NC(=O)C1C(=O)C[C@@H]2C[C@@H]3Cc4c(-c5ccc(NC(=O)NCCCCl)cc5)ccc(O)c4C(=O)C3C(=O)[C@]2(O)C1=O |
| InChI | InChI=1S/C29H28ClN3O8/c30-8-1-9-32-28(40)33-16-4-2-13(3-5-16)17-6-7-19(34)22-18(17)11-14-10-15-12-20(35)23(27(31)39)26(38)29(15,41)25(37)21(14)24(22)36/h2-7,14-15,21,23,34,41H,1,8-12H2,(H2,31,39)(H2,32,33,40)/t14-,15+,21?,23?,29+/m1/s1 |
| InChIKey | XFXAEUTUEITXJP-DXCYOPCPSA-N |
| XLogP | 1.74 |
| TPSA | 192.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.01 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|