C30H28F3NO7 — CID 91130389
(4aS,5aR,12aS)-10-butoxy-12a-hydroxy-1,3,11,12-tetraoxo-7-[4-(trifluoromethyl)phenyl]-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 91130389) has the molecular formula C30H28F3NO7 and a molecular weight of 571.55 g/mol. Its IUPAC name is (4aS,5aR,12aS)-10-butoxy-12a-hydroxy-1,3,11,12-tetraoxo-7-[4-(trifluoromethyl)phenyl]-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4aS,5aR,12aS)-10-butoxy-12a-hydroxy-1,3,11,12-tetraoxo-7-[4-(trifluoromethyl)phenyl]-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 91130389 |
| Molecular Formula | C30H28F3NO7 |
| Molecular Weight | 571.55 g/mol |
| Exact Mass | 571.18 |
| IUPAC Name | (4aS,5aR,12aS)-10-butoxy-12a-hydroxy-1,3,11,12-tetraoxo-7-[4-(trifluoromethyl)phenyl]-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CCCCOc1ccc(-c2ccc(C(F)(F)F)cc2)c2c1C(=O)C1C(=O)[C@]3(O)C(=O)C(C(N)=O)C(=O)C[C@@H]3C[C@@H]1C2 |
| InChI | InChI=1S/C30H28F3NO7/c1-2-3-10-41-21-9-8-18(14-4-6-16(7-5-14)30(31,32)33)19-12-15-11-17-13-20(35)24(28(34)39)27(38)29(17,40)26(37)22(15)25(36)23(19)21/h4-9,15,17,22,24,40H,2-3,10-13H2,1H3,(H2,34,39)/t15-,17+,22?,24?,29+/m1/s1 |
| InChIKey | UKNAIRKNJKHUBM-GUTCOTKXSA-N |
| XLogP | 3.49 |
| TPSA | 140.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.55 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|