C20H20N2O7 — CID 90714035
(4aS,5aR,12aS)-9-(aminomethyl)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 90714035) has the molecular formula C20H20N2O7 and a molecular weight of 400.39 g/mol. Its IUPAC name is (4aS,5aR,12aS)-9-(aminomethyl)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4aS,5aR,12aS)-9-(aminomethyl)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 90714035 |
| Molecular Formula | C20H20N2O7 |
| Molecular Weight | 400.39 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | (4aS,5aR,12aS)-9-(aminomethyl)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | NCc1ccc2c(c1O)C(=O)C1C(=O)[C@]3(O)C(=O)C(C(N)=O)C(=O)C[C@@H]3C[C@@H]1C2 |
| InChI | InChI=1S/C20H20N2O7/c21-6-8-2-1-7-3-9-4-10-5-11(23)14(19(22)28)18(27)20(10,29)17(26)13(9)16(25)12(7)15(8)24/h1-2,9-10,13-14,24,29H,3-6,21H2,(H2,22,28)/t9-,10-,13?,14?,20-/m0/s1 |
| InChIKey | QUXPHFIIOGQWPA-YVBSUOAZSA-N |
| XLogP | -1.21 |
| TPSA | 177.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.39 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|