C22H23NO8 — CID 91097996
(4aS,5aR,12aS)-12a-hydroxy-10-(3-hydroxypropoxy)-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 91097996) has the molecular formula C22H23NO8 and a molecular weight of 429.43 g/mol. Its IUPAC name is (4aS,5aR,12aS)-12a-hydroxy-10-(3-hydroxypropoxy)-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4aS,5aR,12aS)-12a-hydroxy-10-(3-hydroxypropoxy)-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 91097996 |
| Molecular Formula | C22H23NO8 |
| Molecular Weight | 429.43 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | (4aS,5aR,12aS)-12a-hydroxy-10-(3-hydroxypropoxy)-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | NC(=O)C1C(=O)C[C@@H]2C[C@@H]3Cc4cccc(OCCCO)c4C(=O)C3C(=O)[C@]2(O)C1=O |
| InChI | InChI=1S/C22H23NO8/c23-21(29)17-13(25)9-12-8-11-7-10-3-1-4-14(31-6-2-5-24)15(10)18(26)16(11)19(27)22(12,30)20(17)28/h1,3-4,11-12,16-17,24,30H,2,5-9H2,(H2,23,29)/t11-,12-,16?,17?,22-/m0/s1 |
| InChIKey | DOZVFTJMXDZHQQ-PDUYIWNOSA-N |
| XLogP | -0.62 |
| TPSA | 161.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.43 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|