C24H27N3O8 — CID 57140425
10,12a-dihydroxy-1,3,11,12-tetraoxo-9-[[2-(propylamino)acetyl]amino]-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 57140425) has the molecular formula C24H27N3O8 and a molecular weight of 485.49 g/mol. Its IUPAC name is 10,12a-dihydroxy-1,3,11,12-tetraoxo-9-[[2-(propylamino)acetyl]amino]-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | 10,12a-dihydroxy-1,3,11,12-tetraoxo-9-[[2-(propylamino)acetyl]amino]-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 57140425 |
| Molecular Formula | C24H27N3O8 |
| Molecular Weight | 485.49 g/mol |
| Exact Mass | 485.18 |
| IUPAC Name | 10,12a-dihydroxy-1,3,11,12-tetraoxo-9-[[2-(propylamino)acetyl]amino]-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CCCNCC(=O)Nc1ccc2c(c1O)C(=O)C1C(=O)C3(O)C(=O)C(C(N)=O)C(=O)CC3CC1C2 |
| InChI | InChI=1S/C24H27N3O8/c1-2-5-26-9-15(29)27-13-4-3-10-6-11-7-12-8-14(28)18(23(25)34)22(33)24(12,35)21(32)17(11)20(31)16(10)19(13)30/h3-4,11-12,17-18,26,30,35H,2,5-9H2,1H3,(H2,25,34)(H,27,29) |
| InChIKey | SHSYMHWCQMGLQS-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 192.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.49 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|