C29H29FN2O7 — CID 90918956
(4aS,5aR,12aS)-7-[4-[[2-fluoroethyl(methyl)amino]methyl]phenyl]-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 90918956) has the molecular formula C29H29FN2O7 and a molecular weight of 536.56 g/mol. Its IUPAC name is (4aS,5aR,12aS)-7-[4-[[2-fluoroethyl(methyl)amino]methyl]phenyl]-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4aS,5aR,12aS)-7-[4-[[2-fluoroethyl(methyl)amino]methyl]phenyl]-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 90918956 |
| Molecular Formula | C29H29FN2O7 |
| Molecular Weight | 536.56 g/mol |
| Exact Mass | 536.20 |
| IUPAC Name | (4aS,5aR,12aS)-7-[4-[[2-fluoroethyl(methyl)amino]methyl]phenyl]-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CN(CCF)Cc1ccc(-c2ccc(O)c3c2C[C@H]2C[C@H]4CC(=O)C(C(N)=O)C(=O)[C@@]4(O)C(=O)C2C3=O)cc1 |
| InChI | InChI=1S/C29H29FN2O7/c1-32(9-8-30)13-14-2-4-15(5-3-14)18-6-7-20(33)23-19(18)11-16-10-17-12-21(34)24(28(31)38)27(37)29(17,39)26(36)22(16)25(23)35/h2-7,16-17,22,24,33,39H,8-13H2,1H3,(H2,31,38)/t16-,17+,22?,24?,29+/m1/s1 |
| InChIKey | ZIAPUZJQMGKEGG-BOMIOUNMSA-N |
| XLogP | 1.40 |
| TPSA | 155.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.56 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|