C25H24O7 — CID 123861539
2-acetyl-7-cyclopent-2-en-1-yl-10,12a-dihydroxy-4,4a,5,5a,6,11a-hexahydrotetracene-1,3,11,12-tetrone (PubChem CID 123861539) has the molecular formula C25H24O7 and a molecular weight of 436.46 g/mol. Its IUPAC name is 2-acetyl-7-cyclopent-2-en-1-yl-10,12a-dihydroxy-4,4a,5,5a,6,11a-hexahydrotetracene-1,3,11,12-tetrone.
| Compound Name | 2-acetyl-7-cyclopent-2-en-1-yl-10,12a-dihydroxy-4,4a,5,5a,6,11a-hexahydrotetracene-1,3,11,12-tetrone |
|---|---|
| PubChem CID | 123861539 |
| Molecular Formula | C25H24O7 |
| Molecular Weight | 436.46 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | 2-acetyl-7-cyclopent-2-en-1-yl-10,12a-dihydroxy-4,4a,5,5a,6,11a-hexahydrotetracene-1,3,11,12-tetrone |
| SMILES | CC(=O)C1C(=O)CC2CC3Cc4c(C5C=CCC5)ccc(O)c4C(=O)C3C(=O)C2(O)C1=O |
| InChI | InChI=1S/C25H24O7/c1-11(26)19-18(28)10-14-8-13-9-16-15(12-4-2-3-5-12)6-7-17(27)21(16)22(29)20(13)24(31)25(14,32)23(19)30/h2,4,6-7,12-14,19-20,27,32H,3,5,8-10H2,1H3 |
| InChIKey | RSBWHSLHIYZIRZ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 125.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.46 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|