C27H32N2O7 — CID 91099260
(4aS,5aR,12aS)-7-(dimethylamino)-10,12a-dihydroxy-N-(1-methylcyclopentyl)-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 91099260) has the molecular formula C27H32N2O7 and a molecular weight of 496.56 g/mol. Its IUPAC name is (4aS,5aR,12aS)-7-(dimethylamino)-10,12a-dihydroxy-N-(1-methylcyclopentyl)-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4aS,5aR,12aS)-7-(dimethylamino)-10,12a-dihydroxy-N-(1-methylcyclopentyl)-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 91099260 |
| Molecular Formula | C27H32N2O7 |
| Molecular Weight | 496.56 g/mol |
| Exact Mass | 496.22 |
| IUPAC Name | (4aS,5aR,12aS)-7-(dimethylamino)-10,12a-dihydroxy-N-(1-methylcyclopentyl)-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CN(C)c1ccc(O)c2c1C[C@H]1C[C@H]3CC(=O)C(C(=O)NC4(C)CCCC4)C(=O)[C@@]3(O)C(=O)C1C2=O |
| InChI | InChI=1S/C27H32N2O7/c1-26(8-4-5-9-26)28-25(35)21-18(31)12-14-10-13-11-15-16(29(2)3)6-7-17(30)20(15)22(32)19(13)23(33)27(14,36)24(21)34/h6-7,13-14,19,21,30,36H,4-5,8-12H2,1-3H3,(H,28,35)/t13-,14+,19?,21?,27+/m1/s1 |
| InChIKey | NMIJSXHXWGMKLT-WXCASKKTSA-N |
| XLogP | 1.36 |
| TPSA | 141.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.56 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|