C34H28O8 — CID 123881896
2-acetyl-7-(1,3-benzodioxol-5-yl)-10-hydroxy-3-phenylmethoxy-4a,5,5a,6,11a,12a-hexahydro-4H-tetracene-1,11,12-trione (PubChem CID 123881896) has the molecular formula C34H28O8 and a molecular weight of 564.59 g/mol. Its IUPAC name is 2-acetyl-7-(1,3-benzodioxol-5-yl)-10-hydroxy-3-phenylmethoxy-4a,5,5a,6,11a,12a-hexahydro-4H-tetracene-1,11,12-trione.
| Compound Name | 2-acetyl-7-(1,3-benzodioxol-5-yl)-10-hydroxy-3-phenylmethoxy-4a,5,5a,6,11a,12a-hexahydro-4H-tetracene-1,11,12-trione |
|---|---|
| PubChem CID | 123881896 |
| Molecular Formula | C34H28O8 |
| Molecular Weight | 564.59 g/mol |
| Exact Mass | 564.18 |
| IUPAC Name | 2-acetyl-7-(1,3-benzodioxol-5-yl)-10-hydroxy-3-phenylmethoxy-4a,5,5a,6,11a,12a-hexahydro-4H-tetracene-1,11,12-trione |
| SMILES | CC(=O)C1=C(OCc2ccccc2)CC2CC3Cc4c(-c5ccc6c(c5)OCO6)ccc(O)c4C(=O)C3C(=O)C2C1=O |
| InChI | InChI=1S/C34H28O8/c1-17(35)28-27(40-15-18-5-3-2-4-6-18)14-21-11-20-12-23-22(19-7-10-25-26(13-19)42-16-41-25)8-9-24(36)31(23)34(39)29(20)33(38)30(21)32(28)37/h2-10,13,20-21,29-30,36H,11-12,14-16H2,1H3 |
| InChIKey | FXSQZHZMEOEXRY-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.59 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|