C35H34N2O9 — CID 134184942
(4S,4aS,5aR,12aR)-7-(1,3-benzodioxol-5-yl)-4-(dimethylamino)-10,11,12a-trihydroxy-1,12-dioxo-3-phenylmethoxy-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide (PubChem CID 134184942) has the molecular formula C35H34N2O9 and a molecular weight of 626.66 g/mol. Its IUPAC name is (4S,4aS,5aR,12aR)-7-(1,3-benzodioxol-5-yl)-4-(dimethylamino)-10,11,12a-trihydroxy-1,12-dioxo-3-phenylmethoxy-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aR)-7-(1,3-benzodioxol-5-yl)-4-(dimethylamino)-10,11,12a-trihydroxy-1,12-dioxo-3-phenylmethoxy-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 134184942 |
| Molecular Formula | C35H34N2O9 |
| Molecular Weight | 626.66 g/mol |
| Exact Mass | 626.23 |
| IUPAC Name | (4S,4aS,5aR,12aR)-7-(1,3-benzodioxol-5-yl)-4-(dimethylamino)-10,11,12a-trihydroxy-1,12-dioxo-3-phenylmethoxy-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide |
| SMILES | CN(C)[C@@H]1C(OCc2ccccc2)C(C(N)=O)C(=O)[C@@]2(O)C(=O)C3=C(O)c4c(O)ccc(-c5ccc6c(c5)OCO6)c4C[C@H]3C[C@@H]12 |
| InChI | InChI=1S/C35H34N2O9/c1-37(2)29-22-13-19-12-21-20(18-8-11-24-25(14-18)46-16-45-24)9-10-23(38)27(21)30(39)26(19)32(40)35(22,43)33(41)28(34(36)42)31(29)44-15-17-6-4-3-5-7-17/h3-11,14,19,22,28-29,31,38-39,43H,12-13,15-16H2,1-2H3,(H2,36,42)/t19-,22-,28?,29-,31?,35-/m0/s1 |
| InChIKey | OTRJUIGWNHAZPQ-WBSAOYNASA-N |
| XLogP | 2.75 |
| TPSA | 168.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.66 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|