C35H31F3N2O7 — CID 134170212
(4R,4aS,5aR,12aS)-4-(dimethylamino)-10,11,12a-trihydroxy-1,12-dioxo-3-phenylmethoxy-7-[4-(trifluoromethyl)phenyl]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 134170212) has the molecular formula C35H31F3N2O7 and a molecular weight of 648.63 g/mol. Its IUPAC name is (4R,4aS,5aR,12aS)-4-(dimethylamino)-10,11,12a-trihydroxy-1,12-dioxo-3-phenylmethoxy-7-[4-(trifluoromethyl)phenyl]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4R,4aS,5aR,12aS)-4-(dimethylamino)-10,11,12a-trihydroxy-1,12-dioxo-3-phenylmethoxy-7-[4-(trifluoromethyl)phenyl]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 134170212 |
| Molecular Formula | C35H31F3N2O7 |
| Molecular Weight | 648.63 g/mol |
| Exact Mass | 648.21 |
| IUPAC Name | (4R,4aS,5aR,12aS)-4-(dimethylamino)-10,11,12a-trihydroxy-1,12-dioxo-3-phenylmethoxy-7-[4-(trifluoromethyl)phenyl]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CN(C)[C@H]1C(OCc2ccccc2)=C(C(N)=O)C(=O)[C@@]2(O)C(=O)C3=C(O)c4c(O)ccc(-c5ccc(C(F)(F)F)cc5)c4C[C@H]3C[C@@H]12 |
| InChI | InChI=1S/C35H31F3N2O7/c1-40(2)28-23-15-19-14-22-21(18-8-10-20(11-9-18)35(36,37)38)12-13-24(41)26(22)29(42)25(19)31(43)34(23,46)32(44)27(33(39)45)30(28)47-16-17-6-4-3-5-7-17/h3-13,19,23,28,41-42,46H,14-16H2,1-2H3,(H2,39,45)/t19-,23-,28+,34-/m0/s1 |
| InChIKey | PIKIJBSHOHHFGQ-YMVMJBAZSA-N |
| XLogP | 4.31 |
| TPSA | 150.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.63 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|