C35H34N2O7 — CID 137476298
(4R,4aR,5aR,12aS)-4-(dimethylamino)-11,12a-dihydroxy-1,12-dioxo-3,10-bis(phenylmethoxy)-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 137476298) has the molecular formula C35H34N2O7 and a molecular weight of 594.66 g/mol. Its IUPAC name is (4R,4aR,5aR,12aS)-4-(dimethylamino)-11,12a-dihydroxy-1,12-dioxo-3,10-bis(phenylmethoxy)-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4R,4aR,5aR,12aS)-4-(dimethylamino)-11,12a-dihydroxy-1,12-dioxo-3,10-bis(phenylmethoxy)-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 137476298 |
| Molecular Formula | C35H34N2O7 |
| Molecular Weight | 594.66 g/mol |
| Exact Mass | 594.24 |
| IUPAC Name | (4R,4aR,5aR,12aS)-4-(dimethylamino)-11,12a-dihydroxy-1,12-dioxo-3,10-bis(phenylmethoxy)-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CN(C)[C@H]1C(OCc2ccccc2)=C(C(N)=O)C(=O)[C@@]2(O)C(=O)C3=C(O)c4c(cccc4OCc4ccccc4)C[C@H]3C[C@H]12 |
| InChI | InChI=1S/C35H34N2O7/c1-37(2)29-24-17-23-16-22-14-9-15-25(43-18-20-10-5-3-6-11-20)26(22)30(38)27(23)32(39)35(24,42)33(40)28(34(36)41)31(29)44-19-21-12-7-4-8-13-21/h3-15,23-24,29,38,42H,16-19H2,1-2H3,(H2,36,41)/t23-,24+,29+,35-/m0/s1 |
| InChIKey | JZQFJEOCFZQYNJ-UEZAFXILSA-N |
| XLogP | 3.50 |
| TPSA | 139.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.66 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|