C27H30N2O7 — CID 91080296
(4S,4aS,5aR,12aS)-4-(dimethylamino)-12a-hydroxy-1,11,12-trioxo-3,10-bis(prop-2-enoxy)-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 91080296) has the molecular formula C27H30N2O7 and a molecular weight of 494.54 g/mol. Its IUPAC name is (4S,4aS,5aR,12aS)-4-(dimethylamino)-12a-hydroxy-1,11,12-trioxo-3,10-bis(prop-2-enoxy)-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aS)-4-(dimethylamino)-12a-hydroxy-1,11,12-trioxo-3,10-bis(prop-2-enoxy)-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 91080296 |
| Molecular Formula | C27H30N2O7 |
| Molecular Weight | 494.54 g/mol |
| Exact Mass | 494.21 |
| IUPAC Name | (4S,4aS,5aR,12aS)-4-(dimethylamino)-12a-hydroxy-1,11,12-trioxo-3,10-bis(prop-2-enoxy)-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | C=CCOC1=C(C(N)=O)C(=O)[C@@]2(O)C(=O)C3C(=O)c4c(cccc4OCC=C)C[C@H]3C[C@H]2[C@@H]1N(C)C |
| InChI | InChI=1S/C27H30N2O7/c1-5-10-35-17-9-7-8-14-12-15-13-16-21(29(3)4)23(36-11-6-2)20(26(28)33)25(32)27(16,34)24(31)19(15)22(30)18(14)17/h5-9,15-16,19,21,34H,1-2,10-13H2,3-4H3,(H2,28,33)/t15-,16-,19?,21-,27-/m0/s1 |
| InChIKey | DVWXOFLNKWTMGG-WOFODZQCSA-N |
| XLogP | 1.00 |
| TPSA | 136.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.54 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|