C26H26N2O8 — CID 123844435
(4S,4aS,5aR,14aS)-4-(dimethylamino)-12,14a-dihydroxy-8-methoxy-1,3,13,14-tetraoxo-4,4a,5,5a,6,13a-hexahydropentacene-2-carboxamide (PubChem CID 123844435) has the molecular formula C26H26N2O8 and a molecular weight of 494.50 g/mol. Its IUPAC name is (4S,4aS,5aR,14aS)-4-(dimethylamino)-12,14a-dihydroxy-8-methoxy-1,3,13,14-tetraoxo-4,4a,5,5a,6,13a-hexahydropentacene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,14aS)-4-(dimethylamino)-12,14a-dihydroxy-8-methoxy-1,3,13,14-tetraoxo-4,4a,5,5a,6,13a-hexahydropentacene-2-carboxamide |
|---|---|
| PubChem CID | 123844435 |
| Molecular Formula | C26H26N2O8 |
| Molecular Weight | 494.50 g/mol |
| Exact Mass | 494.17 |
| IUPAC Name | (4S,4aS,5aR,14aS)-4-(dimethylamino)-12,14a-dihydroxy-8-methoxy-1,3,13,14-tetraoxo-4,4a,5,5a,6,13a-hexahydropentacene-2-carboxamide |
| SMILES | COc1cccc2c(O)c3c(cc12)C[C@H]1C[C@H]2[C@H](N(C)C)C(=O)C(C(N)=O)C(=O)[C@@]2(O)C(=O)C1C3=O |
| InChI | InChI=1S/C26H26N2O8/c1-28(2)19-14-9-11-7-10-8-13-12(5-4-6-15(13)36-3)20(29)16(10)21(30)17(11)23(32)26(14,35)24(33)18(22(19)31)25(27)34/h4-6,8,11,14,17-19,29,35H,7,9H2,1-3H3,(H2,27,34)/t11-,14-,17?,18?,19-,26-/m0/s1 |
| InChIKey | FFNMTPUSCNDSRV-WYYOCVKQSA-N |
| XLogP | 0.03 |
| TPSA | 164.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.50 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|