C31H37N3O7 — CID 90996490
8-[(tert-butylamino)methyl]-4-(dimethylamino)-12,14a-dihydroxy-9-methyl-1,3,13,14-tetraoxo-4,4a,5,5a,6,13a-hexahydropentacene-2-carboxamide (PubChem CID 90996490) has the molecular formula C31H37N3O7 and a molecular weight of 563.65 g/mol. Its IUPAC name is 8-[(tert-butylamino)methyl]-4-(dimethylamino)-12,14a-dihydroxy-9-methyl-1,3,13,14-tetraoxo-4,4a,5,5a,6,13a-hexahydropentacene-2-carboxamide.
| Compound Name | 8-[(tert-butylamino)methyl]-4-(dimethylamino)-12,14a-dihydroxy-9-methyl-1,3,13,14-tetraoxo-4,4a,5,5a,6,13a-hexahydropentacene-2-carboxamide |
|---|---|
| PubChem CID | 90996490 |
| Molecular Formula | C31H37N3O7 |
| Molecular Weight | 563.65 g/mol |
| Exact Mass | 563.26 |
| IUPAC Name | 8-[(tert-butylamino)methyl]-4-(dimethylamino)-12,14a-dihydroxy-9-methyl-1,3,13,14-tetraoxo-4,4a,5,5a,6,13a-hexahydropentacene-2-carboxamide |
| SMILES | Cc1ccc2c(O)c3c(cc2c1CNC(C)(C)C)CC1CC2C(N(C)C)C(=O)C(C(N)=O)C(=O)C2(O)C(=O)C1C3=O |
| InChI | InChI=1S/C31H37N3O7/c1-13-7-8-16-17(18(13)12-33-30(2,3)4)10-14-9-15-11-19-23(34(5)6)26(37)22(29(32)40)28(39)31(19,41)27(38)21(15)25(36)20(14)24(16)35/h7-8,10,15,19,21-23,33,35,41H,9,11-12H2,1-6H3,(H2,32,40) |
| InChIKey | SXLMXQRSSVPBIP-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 167.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.65 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|