C26H31N3O7 — CID 91353533
(4S,4aS,5aR,12aS)-4-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-9-piperidin-1-yl-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 91353533) has the molecular formula C26H31N3O7 and a molecular weight of 497.55 g/mol. Its IUPAC name is (4S,4aS,5aR,12aS)-4-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-9-piperidin-1-yl-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aS)-4-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-9-piperidin-1-yl-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 91353533 |
| Molecular Formula | C26H31N3O7 |
| Molecular Weight | 497.55 g/mol |
| Exact Mass | 497.22 |
| IUPAC Name | (4S,4aS,5aR,12aS)-4-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-9-piperidin-1-yl-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CN(C)[C@@H]1C(=O)C(C(N)=O)C(=O)[C@@]2(O)C(=O)C3C(=O)c4c(ccc(N5CCCCC5)c4O)C[C@H]3C[C@@H]12 |
| InChI | InChI=1S/C26H31N3O7/c1-28(2)19-14-11-13-10-12-6-7-15(29-8-4-3-5-9-29)20(30)16(12)21(31)17(13)23(33)26(14,36)24(34)18(22(19)32)25(27)35/h6-7,13-14,17-19,30,36H,3-5,8-11H2,1-2H3,(H2,27,35)/t13-,14-,17?,18?,19-,26-/m0/s1 |
| InChIKey | OXCYUQZXGNJRDN-YQLZNPCGSA-N |
| XLogP | -0.14 |
| TPSA | 158.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.55 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|