C25H24N4O9 — CID 91007559
N-[(5aS,6aR,7R,10aR)-9-carbamoyl-7-(dimethylamino)-1,10a-dihydroxy-8,10,11,12-tetraoxo-5,5a,6,6a,7,11a-hexahydrotetracen-2-yl]-1,2-oxazole-5-carboxamide (PubChem CID 91007559) has the molecular formula C25H24N4O9 and a molecular weight of 524.49 g/mol. Its IUPAC name is N-[(5aS,6aR,7R,10aR)-9-carbamoyl-7-(dimethylamino)-1,10a-dihydroxy-8,10,11,12-tetraoxo-5,5a,6,6a,7,11a-hexahydrotetracen-2-yl]-1,2-oxazole-5-carboxamide.
| Compound Name | N-[(5aS,6aR,7R,10aR)-9-carbamoyl-7-(dimethylamino)-1,10a-dihydroxy-8,10,11,12-tetraoxo-5,5a,6,6a,7,11a-hexahydrotetracen-2-yl]-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 91007559 |
| Molecular Formula | C25H24N4O9 |
| Molecular Weight | 524.49 g/mol |
| Exact Mass | 524.15 |
| IUPAC Name | N-[(5aS,6aR,7R,10aR)-9-carbamoyl-7-(dimethylamino)-1,10a-dihydroxy-8,10,11,12-tetraoxo-5,5a,6,6a,7,11a-hexahydrotetracen-2-yl]-1,2-oxazole-5-carboxamide |
| SMILES | CN(C)[C@H]1C(=O)C(C(N)=O)C(=O)[C@]2(O)C(=O)C3C(=O)c4c(ccc(NC(=O)c5ccno5)c4O)C[C@@H]3C[C@H]12 |
| InChI | InChI=1S/C25H24N4O9/c1-29(2)17-11-8-10-7-9-3-4-12(28-24(36)13-5-6-27-38-13)18(30)14(9)19(31)15(10)21(33)25(11,37)22(34)16(20(17)32)23(26)35/h3-6,10-11,15-17,30,37H,7-8H2,1-2H3,(H2,26,35)(H,28,36)/t10-,11-,15?,16?,17-,25-/m1/s1 |
| InChIKey | PCKNLJFEAGWIBJ-SPDUPVQTSA-N |
| XLogP | -0.89 |
| TPSA | 210.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.49 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|