C27H33N5O8 — CID 91484843
(4S)-4-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-9-[[2-oxo-2-(pyrrolidin-1-ylamino)ethyl]amino]-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 91484843) has the molecular formula C27H33N5O8 and a molecular weight of 555.59 g/mol. Its IUPAC name is (4S)-4-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-9-[[2-oxo-2-(pyrrolidin-1-ylamino)ethyl]amino]-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4S)-4-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-9-[[2-oxo-2-(pyrrolidin-1-ylamino)ethyl]amino]-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 91484843 |
| Molecular Formula | C27H33N5O8 |
| Molecular Weight | 555.59 g/mol |
| Exact Mass | 555.23 |
| IUPAC Name | (4S)-4-(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-9-[[2-oxo-2-(pyrrolidin-1-ylamino)ethyl]amino]-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CN(C)[C@@H]1C(=O)C(C(N)=O)C(=O)C2(O)C(=O)C3C(=O)c4c(ccc(NCC(=O)NN5CCCC5)c4O)CC3CC12 |
| InChI | InChI=1S/C27H33N5O8/c1-31(2)20-14-10-13-9-12-5-6-15(29-11-16(33)30-32-7-3-4-8-32)21(34)17(12)22(35)18(13)24(37)27(14,40)25(38)19(23(20)36)26(28)39/h5-6,13-14,18-20,29,34,40H,3-4,7-11H2,1-2H3,(H2,28,39)(H,30,33)/t13?,14?,18?,19?,20-,27?/m0/s1 |
| InChIKey | KZXUMBTXJVJAKA-PSFBMSQVSA-N |
| XLogP | -1.59 |
| TPSA | 199.44 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.59 |
| LogP ≤ 5 | -1.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|