C26H32N4O9 — CID 57225195
(4S,12aS)-4-(dimethylamino)-9-[[2-(dimethylamino)-3-hydroxypropanoyl]amino]-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 57225195) has the molecular formula C26H32N4O9 and a molecular weight of 544.56 g/mol. Its IUPAC name is (4S,12aS)-4-(dimethylamino)-9-[[2-(dimethylamino)-3-hydroxypropanoyl]amino]-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4S,12aS)-4-(dimethylamino)-9-[[2-(dimethylamino)-3-hydroxypropanoyl]amino]-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 57225195 |
| Molecular Formula | C26H32N4O9 |
| Molecular Weight | 544.56 g/mol |
| Exact Mass | 544.22 |
| IUPAC Name | (4S,12aS)-4-(dimethylamino)-9-[[2-(dimethylamino)-3-hydroxypropanoyl]amino]-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CN(C)C(CO)C(=O)Nc1ccc2c(c1O)C(=O)C1C(=O)[C@]3(O)C(=O)C(C(N)=O)C(=O)[C@@H](N(C)C)C3CC1C2 |
| InChI | InChI=1S/C26H32N4O9/c1-29(2)14(9-31)25(38)28-13-6-5-10-7-11-8-12-18(30(3)4)21(34)17(24(27)37)23(36)26(12,39)22(35)16(11)20(33)15(10)19(13)32/h5-6,11-12,14,16-18,31-32,39H,7-9H2,1-4H3,(H2,27,37)(H,28,38)/t11?,12?,14?,16?,17?,18-,26-/m0/s1 |
| InChIKey | USKSPCKUKJQABC-PAGYJIODSA-N |
| XLogP | -2.27 |
| TPSA | 207.64 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.56 |
| LogP ≤ 5 | -2.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|