C27H32N4O9 — CID 57301045
(4S,12aS)-4-(dimethylamino)-10,12a-dihydroxy-9-[[2-[(2-methylcyclopropyl)oxyamino]acetyl]amino]-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 57301045) has the molecular formula C27H32N4O9 and a molecular weight of 556.57 g/mol. Its IUPAC name is (4S,12aS)-4-(dimethylamino)-10,12a-dihydroxy-9-[[2-[(2-methylcyclopropyl)oxyamino]acetyl]amino]-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4S,12aS)-4-(dimethylamino)-10,12a-dihydroxy-9-[[2-[(2-methylcyclopropyl)oxyamino]acetyl]amino]-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 57301045 |
| Molecular Formula | C27H32N4O9 |
| Molecular Weight | 556.57 g/mol |
| Exact Mass | 556.22 |
| IUPAC Name | (4S,12aS)-4-(dimethylamino)-10,12a-dihydroxy-9-[[2-[(2-methylcyclopropyl)oxyamino]acetyl]amino]-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CC1CC1ONCC(=O)Nc1ccc2c(c1O)C(=O)C1C(=O)[C@]3(O)C(=O)C(C(N)=O)C(=O)[C@@H](N(C)C)C3CC1C2 |
| InChI | InChI=1S/C27H32N4O9/c1-10-6-15(10)40-29-9-16(32)30-14-5-4-11-7-12-8-13-20(31(2)3)23(35)19(26(28)38)25(37)27(13,39)24(36)18(12)22(34)17(11)21(14)33/h4-5,10,12-13,15,18-20,29,33,39H,6-9H2,1-3H3,(H2,28,38)(H,30,32)/t10?,12?,13?,15?,18?,19?,20-,27-/m0/s1 |
| InChIKey | QLCCMWKUUOKZNP-WRRKFMNZSA-N |
| XLogP | -1.26 |
| TPSA | 205.43 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.57 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|