C27H33N3O7 — CID 91547638
(4S,4aS,5aR,12aS)-4-(dimethylamino)-7-ethyl-10,12a-dihydroxy-1,3,11,12-tetraoxo-9-[(prop-2-enylamino)methyl]-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 91547638) has the molecular formula C27H33N3O7 and a molecular weight of 511.58 g/mol. Its IUPAC name is (4S,4aS,5aR,12aS)-4-(dimethylamino)-7-ethyl-10,12a-dihydroxy-1,3,11,12-tetraoxo-9-[(prop-2-enylamino)methyl]-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aS)-4-(dimethylamino)-7-ethyl-10,12a-dihydroxy-1,3,11,12-tetraoxo-9-[(prop-2-enylamino)methyl]-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 91547638 |
| Molecular Formula | C27H33N3O7 |
| Molecular Weight | 511.58 g/mol |
| Exact Mass | 511.23 |
| IUPAC Name | (4S,4aS,5aR,12aS)-4-(dimethylamino)-7-ethyl-10,12a-dihydroxy-1,3,11,12-tetraoxo-9-[(prop-2-enylamino)methyl]-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | C=CCNCc1cc(CC)c2c(c1O)C(=O)C1C(=O)[C@]3(O)C(=O)C(C(N)=O)C(=O)[C@@H](N(C)C)[C@@H]3C[C@@H]1C2 |
| InChI | InChI=1S/C27H33N3O7/c1-5-7-29-11-14-8-12(6-2)15-9-13-10-16-20(30(3)4)23(33)19(26(28)36)25(35)27(16,37)24(34)17(13)22(32)18(15)21(14)31/h5,8,13,16-17,19-20,29,31,37H,1,6-7,9-11H2,2-4H3,(H2,28,36)/t13-,16-,17?,19?,20-,27-/m0/s1 |
| InChIKey | ARGIJYPUCYVVGP-DEXBIHPKSA-N |
| XLogP | -0.29 |
| TPSA | 167.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.58 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|