C27H27NO8S — CID 118504958
[7-(dimethylamino)-10,10a,12-trihydroxy-9-methyl-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-1-yl] benzenesulfonate (PubChem CID 118504958) has the molecular formula C27H27NO8S and a molecular weight of 525.58 g/mol. Its IUPAC name is [7-(dimethylamino)-10,10a,12-trihydroxy-9-methyl-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-1-yl] benzenesulfonate.
| Compound Name | [7-(dimethylamino)-10,10a,12-trihydroxy-9-methyl-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-1-yl] benzenesulfonate |
|---|---|
| PubChem CID | 118504958 |
| Molecular Formula | C27H27NO8S |
| Molecular Weight | 525.58 g/mol |
| Exact Mass | 525.15 |
| IUPAC Name | [7-(dimethylamino)-10,10a,12-trihydroxy-9-methyl-8,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-1-yl] benzenesulfonate |
| SMILES | CC1=C(O)C2(O)C(=O)C3=C(O)c4c(cccc4OS(=O)(=O)c4ccccc4)CC3CC2C(N(C)C)C1=O |
| InChI | InChI=1S/C27H27NO8S/c1-14-23(29)22(28(2)3)18-13-16-12-15-8-7-11-19(36-37(34,35)17-9-5-4-6-10-17)20(15)24(30)21(16)26(32)27(18,33)25(14)31/h4-11,16,18,22,30-31,33H,12-13H2,1-3H3 |
| InChIKey | MBLLINPOYVMMMJ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 141.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.58 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|