C24H26N2O6 — CID 123479264
10-hydroxy-1,3,11,12-tetraoxo-9-piperidin-1-yl-4a,5,5a,6,11a,12a-hexahydro-4H-tetracene-2-carboxamide (PubChem CID 123479264) has the molecular formula C24H26N2O6 and a molecular weight of 438.48 g/mol. Its IUPAC name is 10-hydroxy-1,3,11,12-tetraoxo-9-piperidin-1-yl-4a,5,5a,6,11a,12a-hexahydro-4H-tetracene-2-carboxamide.
| Compound Name | 10-hydroxy-1,3,11,12-tetraoxo-9-piperidin-1-yl-4a,5,5a,6,11a,12a-hexahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 123479264 |
| Molecular Formula | C24H26N2O6 |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | 10-hydroxy-1,3,11,12-tetraoxo-9-piperidin-1-yl-4a,5,5a,6,11a,12a-hexahydro-4H-tetracene-2-carboxamide |
| SMILES | NC(=O)C1C(=O)CC2CC3Cc4ccc(N5CCCCC5)c(O)c4C(=O)C3C(=O)C2C1=O |
| InChI | InChI=1S/C24H26N2O6/c25-24(32)19-15(27)10-13-9-12-8-11-4-5-14(26-6-2-1-3-7-26)20(28)16(11)21(29)17(12)22(30)18(13)23(19)31/h4-5,12-13,17-19,28H,1-3,6-10H2,(H2,25,32) |
| InChIKey | WSHNSJIZXZGWIO-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 134.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|