C19H16BrNO8 — CID 91128652
(4aR,5S,5aR,12aS)-9-bromo-5,10,12a-trihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 91128652) has the molecular formula C19H16BrNO8 and a molecular weight of 466.24 g/mol. Its IUPAC name is (4aR,5S,5aR,12aS)-9-bromo-5,10,12a-trihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4aR,5S,5aR,12aS)-9-bromo-5,10,12a-trihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 91128652 |
| Molecular Formula | C19H16BrNO8 |
| Molecular Weight | 466.24 g/mol |
| Exact Mass | 465.01 |
| IUPAC Name | (4aR,5S,5aR,12aS)-9-bromo-5,10,12a-trihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | NC(=O)C1C(=O)C[C@@H]2[C@@H](O)[C@@H]3Cc4ccc(Br)c(O)c4C(=O)C3C(=O)[C@]2(O)C1=O |
| InChI | InChI=1S/C19H16BrNO8/c20-8-2-1-5-3-6-11(15(25)10(5)14(8)24)16(26)19(29)7(13(6)23)4-9(22)12(17(19)27)18(21)28/h1-2,6-7,11-13,23-24,29H,3-4H2,(H2,21,28)/t6-,7-,11?,12?,13+,19+/m1/s1 |
| InChIKey | TYTWLZULNKIHBC-HOIJVAOTSA-N |
| XLogP | -0.94 |
| TPSA | 172.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.24 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|